About 5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepine
5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepine (PubChem CID 86585811) has the molecular formula C15H22FN2O3P
and a molecular weight of 328.32 g/mol. Its IUPAC name is 5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepine.
Molecular Properties
| Compound Name | 5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepine |
| PubChem CID | 86585811 |
| Molecular Formula | C15H22FN2O3P |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepine |
| SMILES | CCOP(=O)(C=C1NCCN(C)c2ccc(F)cc21)OCC |
| InChI | InChI=1S/C15H22FN2O3P/c1-4-20-22(19,21-5-2)11-14-13-10-12(16)6-7-15(13)18(3)9-8-17-14/h6-7,10-11,17H,4-5,8-9H2,1-3H3 |
| InChIKey | CTNCCQQZTDWUAG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepine?
The IUPAC name of 5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepine (CID 86585811) is 5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepine.
What is the SMILES notation for 5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepine?
The canonical SMILES for 5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepine is CCOP(=O)(C=C1NCCN(C)c2ccc(F)cc21)OCC.
What is the InChIKey of 5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepine?
The InChIKey is CTNCCQQZTDWUAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22FN2O3P/c1-4-20-22(19,21-5-2)11-14-13-10-12(16)6-7-15(13)18(3)9-8-17-14/h6-7,10-11,17H,4-5,8-9H2,1-3H3.
What are the key properties of 5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepine?
5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepine has a molecular weight of 328.32 g/mol, XLogP of 3.43, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepine is sourced from PubChem (CID 86585811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).