C9H13Na — CID 86585831
sodium 1,2,3,5-tetramethylcyclopenta-1,3-diene (PubChem CID 86585831) has the molecular formula C9H13Na and a molecular weight of 144.19 g/mol. Its IUPAC name is sodium 1,2,3,5-tetramethylcyclopenta-1,3-diene.
| Compound Name | sodium 1,2,3,5-tetramethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 86585831 |
| Molecular Formula | C9H13Na |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | sodium 1,2,3,5-tetramethylcyclopenta-1,3-diene |
| SMILES | Cc1c[c-](C)c(C)c1C.[Na+] |
| InChI | InChI=1S/C9H13.Na/c1-6-5-7(2)9(4)8(6)3;/h5H,1-4H3;/q-1;+1 |
| InChIKey | HRPNMORYKXSLTM-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|