About 4-butan-2-yl-6-tert-butylspiro[3H-1-benzofuran-2,1'-cycloheptane]-5-ol
4-butan-2-yl-6-tert-butylspiro[3H-1-benzofuran-2,1'-cycloheptane]-5-ol (PubChem CID 86586192) has the molecular formula C22H34O2
and a molecular weight of 330.51 g/mol. Its IUPAC name is 4-butan-2-yl-6-tert-butylspiro[3H-1-benzofuran-2,1'-cycloheptane]-5-ol.
Molecular Properties
| Compound Name | 4-butan-2-yl-6-tert-butylspiro[3H-1-benzofuran-2,1'-cycloheptane]-5-ol |
| PubChem CID | 86586192 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | 4-butan-2-yl-6-tert-butylspiro[3H-1-benzofuran-2,1'-cycloheptane]-5-ol |
| SMILES | CCC(C)c1c(O)c(C(C)(C)C)cc2c1CC1(CCCCCC1)O2 |
| InChI | InChI=1S/C22H34O2/c1-6-15(2)19-16-14-22(11-9-7-8-10-12-22)24-18(16)13-17(20(19)23)21(3,4)5/h13,15,23H,6-12,14H2,1-5H3 |
| InChIKey | OPNIDTSTTNKWHT-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butan-2-yl-6-tert-butylspiro[3H-1-benzofuran-2,1'-cycloheptane]-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-6-tert-butylspiro[3H-1-benzofuran-2,1'-cycloheptane]-5-ol?
The IUPAC name of 4-butan-2-yl-6-tert-butylspiro[3H-1-benzofuran-2,1'-cycloheptane]-5-ol (CID 86586192) is 4-butan-2-yl-6-tert-butylspiro[3H-1-benzofuran-2,1'-cycloheptane]-5-ol.
What is the SMILES notation for 4-butan-2-yl-6-tert-butylspiro[3H-1-benzofuran-2,1'-cycloheptane]-5-ol?
The canonical SMILES for 4-butan-2-yl-6-tert-butylspiro[3H-1-benzofuran-2,1'-cycloheptane]-5-ol is CCC(C)c1c(O)c(C(C)(C)C)cc2c1CC1(CCCCCC1)O2.
What is the InChIKey of 4-butan-2-yl-6-tert-butylspiro[3H-1-benzofuran-2,1'-cycloheptane]-5-ol?
The InChIKey is OPNIDTSTTNKWHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34O2/c1-6-15(2)19-16-14-22(11-9-7-8-10-12-22)24-18(16)13-17(20(19)23)21(3,4)5/h13,15,23H,6-12,14H2,1-5H3.
What are the key properties of 4-butan-2-yl-6-tert-butylspiro[3H-1-benzofuran-2,1'-cycloheptane]-5-ol?
4-butan-2-yl-6-tert-butylspiro[3H-1-benzofuran-2,1'-cycloheptane]-5-ol has a molecular weight of 330.51 g/mol, XLogP of 6.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-6-tert-butylspiro[3H-1-benzofuran-2,1'-cycloheptane]-5-ol is sourced from PubChem (CID 86586192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).