About acetic acid;1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine
acetic acid;1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 86586295) has the molecular formula C14H22N6O4
and a molecular weight of 338.37 g/mol. Its IUPAC name is acetic acid;1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | acetic acid;1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 86586295 |
| Molecular Formula | C14H22N6O4 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | acetic acid;1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CC(=O)O.CC(=O)O.Nc1ncnc2c1cnn2C1CCNCC1 |
| InChI | InChI=1S/C10H14N6.2C2H4O2/c11-9-8-5-15-16(10(8)14-6-13-9)7-1-3-12-4-2-7;2*1-2(3)4/h5-7,12H,1-4H2,(H2,11,13,14);2*1H3,(H,3,4) |
| InChIKey | OWFXUHPESVSDBD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 156.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze acetic acid;1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of acetic acid;1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine (CID 86586295) is acetic acid;1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for acetic acid;1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for acetic acid;1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine is CC(=O)O.CC(=O)O.Nc1ncnc2c1cnn2C1CCNCC1.
What is the InChIKey of acetic acid;1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is OWFXUHPESVSDBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6.2C2H4O2/c11-9-8-5-15-16(10(8)14-6-13-9)7-1-3-12-4-2-7;2*1-2(3)4/h5-7,12H,1-4H2,(H2,11,13,14);2*1H3,(H,3,4).
What are the key properties of acetic acid;1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine?
acetic acid;1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 338.37 g/mol, XLogP of 0.51, 1 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 86586295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).