About N,N-dimethylformamide;sulfur dioxide
N,N-dimethylformamide;sulfur dioxide (PubChem CID 86586388) has the molecular formula C3H7NO3S
and a molecular weight of 137.16 g/mol. Its IUPAC name is N,N-dimethylformamide;sulfur dioxide.
Molecular Properties
| Compound Name | N,N-dimethylformamide;sulfur dioxide |
| PubChem CID | 86586388 |
| Molecular Formula | C3H7NO3S |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 137.01 |
| IUPAC Name | N,N-dimethylformamide;sulfur dioxide |
| SMILES | CN(C)C=O.O=S=O |
| InChI | InChI=1S/C3H7NO.O2S/c1-4(2)3-5;1-3-2/h3H,1-2H3; |
| InChIKey | UPKMQTOHAIDTHY-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;sulfur dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;sulfur dioxide?
The IUPAC name of N,N-dimethylformamide;sulfur dioxide (CID 86586388) is N,N-dimethylformamide;sulfur dioxide.
What is the SMILES notation for N,N-dimethylformamide;sulfur dioxide?
The canonical SMILES for N,N-dimethylformamide;sulfur dioxide is CN(C)C=O.O=S=O.
What is the InChIKey of N,N-dimethylformamide;sulfur dioxide?
The InChIKey is UPKMQTOHAIDTHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.O2S/c1-4(2)3-5;1-3-2/h3H,1-2H3;.
What are the key properties of N,N-dimethylformamide;sulfur dioxide?
N,N-dimethylformamide;sulfur dioxide has a molecular weight of 137.16 g/mol, XLogP of -0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;sulfur dioxide is sourced from PubChem (CID 86586388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).