About [(2R)-8-propan-2-yloxy-3,4-dihydro-2H-chromen-2-yl]methyl methanesulfonate
[(2R)-8-propan-2-yloxy-3,4-dihydro-2H-chromen-2-yl]methyl methanesulfonate (PubChem CID 86586482) has the molecular formula C14H20O5S
and a molecular weight of 300.38 g/mol. Its IUPAC name is [(2R)-8-propan-2-yloxy-3,4-dihydro-2H-chromen-2-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [(2R)-8-propan-2-yloxy-3,4-dihydro-2H-chromen-2-yl]methyl methanesulfonate |
| PubChem CID | 86586482 |
| Molecular Formula | C14H20O5S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | [(2R)-8-propan-2-yloxy-3,4-dihydro-2H-chromen-2-yl]methyl methanesulfonate |
| SMILES | CC(C)Oc1cccc2c1O[C@@H](COS(C)(=O)=O)CC2 |
| InChI | InChI=1S/C14H20O5S/c1-10(2)18-13-6-4-5-11-7-8-12(19-14(11)13)9-17-20(3,15)16/h4-6,10,12H,7-9H2,1-3H3/t12-/m1/s1 |
| InChIKey | SXOVDPLNZCMPDY-GFCCVEGCSA-N |
| XLogP | 2.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-8-propan-2-yloxy-3,4-dihydro-2H-chromen-2-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-8-propan-2-yloxy-3,4-dihydro-2H-chromen-2-yl]methyl methanesulfonate?
The IUPAC name of [(2R)-8-propan-2-yloxy-3,4-dihydro-2H-chromen-2-yl]methyl methanesulfonate (CID 86586482) is [(2R)-8-propan-2-yloxy-3,4-dihydro-2H-chromen-2-yl]methyl methanesulfonate.
What is the SMILES notation for [(2R)-8-propan-2-yloxy-3,4-dihydro-2H-chromen-2-yl]methyl methanesulfonate?
The canonical SMILES for [(2R)-8-propan-2-yloxy-3,4-dihydro-2H-chromen-2-yl]methyl methanesulfonate is CC(C)Oc1cccc2c1O[C@@H](COS(C)(=O)=O)CC2.
What is the InChIKey of [(2R)-8-propan-2-yloxy-3,4-dihydro-2H-chromen-2-yl]methyl methanesulfonate?
The InChIKey is SXOVDPLNZCMPDY-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H20O5S/c1-10(2)18-13-6-4-5-11-7-8-12(19-14(11)13)9-17-20(3,15)16/h4-6,10,12H,7-9H2,1-3H3/t12-/m1/s1.
What are the key properties of [(2R)-8-propan-2-yloxy-3,4-dihydro-2H-chromen-2-yl]methyl methanesulfonate?
[(2R)-8-propan-2-yloxy-3,4-dihydro-2H-chromen-2-yl]methyl methanesulfonate has a molecular weight of 300.38 g/mol, XLogP of 2.14, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-8-propan-2-yloxy-3,4-dihydro-2H-chromen-2-yl]methyl methanesulfonate is sourced from PubChem (CID 86586482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).