C38H35F6N5O2 — CID 86586769
(1R,2R,5S,6R)-8-benzyl-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-phenylmethoxyethoxy]-1-phenyl-6-(2H-tetrazol-5-yl)-8-azabicyclo[3.2.1]octane (PubChem CID 86586769) has the molecular formula C38H35F6N5O2 and a molecular weight of 707.72 g/mol. Its IUPAC name is (1R,2R,5S,6R)-8-benzyl-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-phenylmethoxyethoxy]-1-phenyl-6-(2H-tetrazol-5-yl)-8-azabicyclo[3.2.1]octane.
| Compound Name | (1R,2R,5S,6R)-8-benzyl-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-phenylmethoxyethoxy]-1-phenyl-6-(2H-tetrazol-5-yl)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 86586769 |
| Molecular Formula | C38H35F6N5O2 |
| Molecular Weight | 707.72 g/mol |
| Exact Mass | 707.27 |
| IUPAC Name | (1R,2R,5S,6R)-8-benzyl-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-phenylmethoxyethoxy]-1-phenyl-6-(2H-tetrazol-5-yl)-8-azabicyclo[3.2.1]octane |
| SMILES | FC(F)(F)c1cc([C@H](COCc2ccccc2)O[C@@H]2CC[C@H]3[C@H](c4nn[nH]n4)C[C@]2(c2ccccc2)N3Cc2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C38H35F6N5O2/c39-37(40,41)29-18-27(19-30(20-29)38(42,43)44)33(24-50-23-26-12-6-2-7-13-26)51-34-17-16-32-31(35-45-47-48-46-35)21-36(34,28-14-8-3-9-15-28)49(32)22-25-10-4-1-5-11-25/h1-15,18-20,31-34H,16-17,21-24H2,(H,45,46,47,48)/t31-,32+,33+,34-,36-/m1/s1 |
| InChIKey | QFNPQCDWFHLPHA-YKMXLWNGSA-N |
| XLogP | 8.63 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.72 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |