About [tert-butyl(dimethyl)silyl] 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate
[tert-butyl(dimethyl)silyl] 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate (PubChem CID 86587277) has the molecular formula C13H24O5Si
and a molecular weight of 288.42 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate.
Molecular Properties
| Compound Name | [tert-butyl(dimethyl)silyl] 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate |
| PubChem CID | 86587277 |
| Molecular Formula | C13H24O5Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate |
| SMILES | CC1(C)OC(=O)[C@H](CC(=O)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C13H24O5Si/c1-12(2,3)19(6,7)18-10(14)8-9-11(15)17-13(4,5)16-9/h9H,8H2,1-7H3/t9-/m0/s1 |
| InChIKey | UZUBJZMQRZAEFN-VIFPVBQESA-N |
| XLogP | 2.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [tert-butyl(dimethyl)silyl] 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tert-butyl(dimethyl)silyl] 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate?
The IUPAC name of [tert-butyl(dimethyl)silyl] 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate (CID 86587277) is [tert-butyl(dimethyl)silyl] 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate.
What is the SMILES notation for [tert-butyl(dimethyl)silyl] 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate?
The canonical SMILES for [tert-butyl(dimethyl)silyl] 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate is CC1(C)OC(=O)[C@H](CC(=O)O[Si](C)(C)C(C)(C)C)O1.
What is the InChIKey of [tert-butyl(dimethyl)silyl] 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate?
The InChIKey is UZUBJZMQRZAEFN-VIFPVBQESA-N. The full InChI is InChI=1S/C13H24O5Si/c1-12(2,3)19(6,7)18-10(14)8-9-11(15)17-13(4,5)16-9/h9H,8H2,1-7H3/t9-/m0/s1.
What are the key properties of [tert-butyl(dimethyl)silyl] 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate?
[tert-butyl(dimethyl)silyl] 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate has a molecular weight of 288.42 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [tert-butyl(dimethyl)silyl] 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate is sourced from PubChem (CID 86587277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).