C22H14Br2F6O2 — CID 86588170
1,4-dibromo-2,5-bis[[2-(trifluoromethyl)phenoxy]methyl]benzene (PubChem CID 86588170) has the molecular formula C22H14Br2F6O2 and a molecular weight of 584.15 g/mol. Its IUPAC name is 1,4-dibromo-2,5-bis[[2-(trifluoromethyl)phenoxy]methyl]benzene.
| Compound Name | 1,4-dibromo-2,5-bis[[2-(trifluoromethyl)phenoxy]methyl]benzene |
|---|---|
| PubChem CID | 86588170 |
| Molecular Formula | C22H14Br2F6O2 |
| Molecular Weight | 584.15 g/mol |
| Exact Mass | 581.93 |
| IUPAC Name | 1,4-dibromo-2,5-bis[[2-(trifluoromethyl)phenoxy]methyl]benzene |
| SMILES | FC(F)(F)c1ccccc1OCc1cc(Br)c(COc2ccccc2C(F)(F)F)cc1Br |
| InChI | InChI=1S/C22H14Br2F6O2/c23-17-10-14(12-32-20-8-4-2-6-16(20)22(28,29)30)18(24)9-13(17)11-31-19-7-3-1-5-15(19)21(25,26)27/h1-10H,11-12H2 |
| InChIKey | FJTDBRSUUVKOEV-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.15 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |