C16H31IO2Si — CID 86588744
tert-butyl-[(3S,4S,5Z)-2-ethoxy-6-iodo-4-methylhepta-1,5-dien-3-yl]oxy-dimethylsilane (PubChem CID 86588744) has the molecular formula C16H31IO2Si and a molecular weight of 410.41 g/mol. Its IUPAC name is tert-butyl-[(3S,4S,5Z)-2-ethoxy-6-iodo-4-methylhepta-1,5-dien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4S,5Z)-2-ethoxy-6-iodo-4-methylhepta-1,5-dien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 86588744 |
| Molecular Formula | C16H31IO2Si |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | tert-butyl-[(3S,4S,5Z)-2-ethoxy-6-iodo-4-methylhepta-1,5-dien-3-yl]oxy-dimethylsilane |
| SMILES | C=C(OCC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C(/C)I |
| InChI | InChI=1S/C16H31IO2Si/c1-10-18-14(4)15(12(2)11-13(3)17)19-20(8,9)16(5,6)7/h11-12,15H,4,10H2,1-3,5-9H3/b13-11-/t12-,15-/m0/s1 |
| InChIKey | FSMDVHSQVFUYRM-AYTLTXPASA-N |
| XLogP | 5.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|