C14H18O5 — CID 86588771
2-[[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]acetic acid (PubChem CID 86588771) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 2-[[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]acetic acid.
| Compound Name | 2-[[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 86588771 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-[[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]acetic acid |
| SMILES | C#C/C=C/C=C/[C@H]1OC(C)(C)O[C@H]1COCC(=O)O |
| InChI | InChI=1S/C14H18O5/c1-4-5-6-7-8-11-12(9-17-10-13(15)16)19-14(2,3)18-11/h1,5-8,11-12H,9-10H2,2-3H3,(H,15,16)/b6-5+,8-7+/t11-,12+/m1/s1 |
| InChIKey | OTPOROUTDQYNNM-JBPJPUBUSA-N |
| XLogP | 1.35 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|