C16H16N6O5 — CID 86589079
N-[1-[(2R,3R,4S,5R)-5-(azidomethyl)-3,4-dihydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 86589079) has the molecular formula C16H16N6O5 and a molecular weight of 372.34 g/mol. Its IUPAC name is N-[1-[(2R,3R,4S,5R)-5-(azidomethyl)-3,4-dihydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,3R,4S,5R)-5-(azidomethyl)-3,4-dihydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 86589079 |
| Molecular Formula | C16H16N6O5 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-[1-[(2R,3R,4S,5R)-5-(azidomethyl)-3,4-dihydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | [N-]=[N+]=NC[C@H]1O[C@@H](n2ccc(NC(=O)c3ccccc3)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H16N6O5/c17-21-18-8-10-12(23)13(24)15(27-10)22-7-6-11(20-16(22)26)19-14(25)9-4-2-1-3-5-9/h1-7,10,12-13,15,23-24H,8H2,(H,19,20,25,26)/t10-,12-,13-,15-/m1/s1 |
| InChIKey | QQBYZDOZNVBXGR-BPGGGUHBSA-N |
| XLogP | 0.43 |
| TPSA | 162.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|