C13H15N3O2S — CID 86589093
1-pyridazin-3-ylsulfonyl-3,4,4a,5-tetrahydro-2H-quinoline (PubChem CID 86589093) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 1-pyridazin-3-ylsulfonyl-3,4,4a,5-tetrahydro-2H-quinoline.
| Compound Name | 1-pyridazin-3-ylsulfonyl-3,4,4a,5-tetrahydro-2H-quinoline |
|---|---|
| PubChem CID | 86589093 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-pyridazin-3-ylsulfonyl-3,4,4a,5-tetrahydro-2H-quinoline |
| SMILES | O=S(=O)(c1cccnn1)N1CCCC2CC=CC=C21 |
| InChI | InChI=1S/C13H15N3O2S/c17-19(18,13-8-3-9-14-15-13)16-10-4-6-11-5-1-2-7-12(11)16/h1-3,7-9,11H,4-6,10H2 |
| InChIKey | SNHNLPNXWYDXGO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |