C19H23NO5S2 — CID 86590611
2-(4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)-3-methylsulfanylcyclohexan-1-one (PubChem CID 86590611) has the molecular formula C19H23NO5S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-(4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)-3-methylsulfanylcyclohexan-1-one.
| Compound Name | 2-(4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)-3-methylsulfanylcyclohexan-1-one |
|---|---|
| PubChem CID | 86590611 |
| Molecular Formula | C19H23NO5S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2-(4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)-3-methylsulfanylcyclohexan-1-one |
| SMILES | CON=C1CCS(=O)(=O)c2ccc(C(=O)C3C(=O)CCCC3SC)c(C)c21 |
| InChI | InChI=1S/C19H23NO5S2/c1-11-12(19(22)18-14(21)5-4-6-15(18)26-3)7-8-16-17(11)13(20-25-2)9-10-27(16,23)24/h7-8,15,18H,4-6,9-10H2,1-3H3 |
| InChIKey | DQRYINGBRKKQKB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 89.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|