C26H33NO4 — CID 86591245
methyl (2R)-2-[[(3R,4R)-4-(3-acetyloxyphenyl)-3,4-dimethylpiperidin-1-yl]methyl]-3-phenylpropanoate (PubChem CID 86591245) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is methyl (2R)-2-[[(3R,4R)-4-(3-acetyloxyphenyl)-3,4-dimethylpiperidin-1-yl]methyl]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[[(3R,4R)-4-(3-acetyloxyphenyl)-3,4-dimethylpiperidin-1-yl]methyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 86591245 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | methyl (2R)-2-[[(3R,4R)-4-(3-acetyloxyphenyl)-3,4-dimethylpiperidin-1-yl]methyl]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)CN1CC[C@@](C)(c2cccc(OC(C)=O)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C26H33NO4/c1-19-17-27(18-22(25(29)30-4)15-21-9-6-5-7-10-21)14-13-26(19,3)23-11-8-12-24(16-23)31-20(2)28/h5-12,16,19,22H,13-15,17-18H2,1-4H3/t19-,22+,26+/m0/s1 |
| InChIKey | ZNFIETJSBXCFRX-IATMXGELSA-N |
| XLogP | 4.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|