C26H33N3O2 — CID 86591429
N-phenylmethoxy-8-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)octanamide (PubChem CID 86591429) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-phenylmethoxy-8-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)octanamide.
| Compound Name | N-phenylmethoxy-8-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)octanamide |
|---|---|
| PubChem CID | 86591429 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | N-phenylmethoxy-8-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)octanamide |
| SMILES | O=C(CCCCCCCN1CCc2c([nH]c3ccccc23)C1)NOCc1ccccc1 |
| InChI | InChI=1S/C26H33N3O2/c30-26(28-31-20-21-11-5-4-6-12-21)15-7-2-1-3-10-17-29-18-16-23-22-13-8-9-14-24(22)27-25(23)19-29/h4-6,8-9,11-14,27H,1-3,7,10,15-20H2,(H,28,30) |
| InChIKey | FRMORBVSQCHTSG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|