C16H24O6 — CID 86591833
6-O-tert-butyl 1-O,2-O-dimethyl 1-methylhexa-1,4-diene-1,2,6-tricarboxylate (PubChem CID 86591833) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is 6-O-tert-butyl 1-O,2-O-dimethyl 1-methylhexa-1,4-diene-1,2,6-tricarboxylate.
| Compound Name | 6-O-tert-butyl 1-O,2-O-dimethyl 1-methylhexa-1,4-diene-1,2,6-tricarboxylate |
|---|---|
| PubChem CID | 86591833 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 6-O-tert-butyl 1-O,2-O-dimethyl 1-methylhexa-1,4-diene-1,2,6-tricarboxylate |
| SMILES | COC(=O)C(C)=C(CC=CCC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C16H24O6/c1-11(14(18)20-5)12(15(19)21-6)9-7-8-10-13(17)22-16(2,3)4/h7-8H,9-10H2,1-6H3 |
| InChIKey | RBVPRBYHEDCYFD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|