C32H35FN2O3S — CID 86592369
5-[[3-[3-(1-adamantyl)-5-fluoro-4-hydroxyphenyl]phenyl]methylidene]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one (PubChem CID 86592369) has the molecular formula C32H35FN2O3S and a molecular weight of 546.71 g/mol. Its IUPAC name is 5-[[3-[3-(1-adamantyl)-5-fluoro-4-hydroxyphenyl]phenyl]methylidene]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one.
| Compound Name | 5-[[3-[3-(1-adamantyl)-5-fluoro-4-hydroxyphenyl]phenyl]methylidene]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 86592369 |
| Molecular Formula | C32H35FN2O3S |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 5-[[3-[3-(1-adamantyl)-5-fluoro-4-hydroxyphenyl]phenyl]methylidene]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one |
| SMILES | C[C@H]1CN(C2=NC(=O)C(=Cc3cccc(-c4cc(F)c(O)c(C56CC7CC(CC(C7)C5)C6)c4)c3)S2)C[C@H](C)O1 |
| InChI | InChI=1S/C32H35FN2O3S/c1-18-16-35(17-19(2)38-18)31-34-30(37)28(39-31)10-20-4-3-5-24(9-20)25-11-26(29(36)27(33)12-25)32-13-21-6-22(14-32)8-23(7-21)15-32/h3-5,9-12,18-19,21-23,36H,6-8,13-17H2,1-2H3/t18-,19-,21?,22?,23?,32?/m0/s1 |
| InChIKey | XYOBRIUHELWOIS-MMYSMTJCSA-N |
| XLogP | 6.75 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|