About (7-bromo-1H-indol-5-yl) benzenesulfonate
(7-bromo-1H-indol-5-yl) benzenesulfonate (PubChem CID 86592475) has the molecular formula C14H10BrNO3S
and a molecular weight of 352.21 g/mol. Its IUPAC name is (7-bromo-1H-indol-5-yl) benzenesulfonate.
Molecular Properties
| Compound Name | (7-bromo-1H-indol-5-yl) benzenesulfonate |
| PubChem CID | 86592475 |
| Molecular Formula | C14H10BrNO3S |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | (7-bromo-1H-indol-5-yl) benzenesulfonate |
| SMILES | O=S(=O)(Oc1cc(Br)c2[nH]ccc2c1)c1ccccc1 |
| InChI | InChI=1S/C14H10BrNO3S/c15-13-9-11(8-10-6-7-16-14(10)13)19-20(17,18)12-4-2-1-3-5-12/h1-9,16H |
| InChIKey | PHZOVXDZZMVGIX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (7-bromo-1H-indol-5-yl) benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-bromo-1H-indol-5-yl) benzenesulfonate?
The IUPAC name of (7-bromo-1H-indol-5-yl) benzenesulfonate (CID 86592475) is (7-bromo-1H-indol-5-yl) benzenesulfonate.
What is the SMILES notation for (7-bromo-1H-indol-5-yl) benzenesulfonate?
The canonical SMILES for (7-bromo-1H-indol-5-yl) benzenesulfonate is O=S(=O)(Oc1cc(Br)c2[nH]ccc2c1)c1ccccc1.
What is the InChIKey of (7-bromo-1H-indol-5-yl) benzenesulfonate?
The InChIKey is PHZOVXDZZMVGIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrNO3S/c15-13-9-11(8-10-6-7-16-14(10)13)19-20(17,18)12-4-2-1-3-5-12/h1-9,16H.
What are the key properties of (7-bromo-1H-indol-5-yl) benzenesulfonate?
(7-bromo-1H-indol-5-yl) benzenesulfonate has a molecular weight of 352.21 g/mol, XLogP of 3.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-bromo-1H-indol-5-yl) benzenesulfonate is sourced from PubChem (CID 86592475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).