C10H10ClN2O2S2- — CID 86592512
(2S)-2-(chloromethyl)-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 86592512) has the molecular formula C10H10ClN2O2S2- and a molecular weight of 289.79 g/mol. Its IUPAC name is (2S)-2-(chloromethyl)-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | (2S)-2-(chloromethyl)-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 86592512 |
| Molecular Formula | C10H10ClN2O2S2- |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | (2S)-2-(chloromethyl)-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | O=C([O-])N1CC=C(c2csc(=S)[nH]2)C[C@H]1CCl |
| InChI | InChI=1S/C10H11ClN2O2S2/c11-4-7-3-6(1-2-13(7)10(14)15)8-5-17-9(16)12-8/h1,5,7H,2-4H2,(H,12,16)(H,14,15)/p-1/t7-/m0/s1 |
| InChIKey | TVSMXRQNPUGRMJ-ZETCQYMHSA-M |
| XLogP | 1.85 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|