C40H50 — CID 86592750
1,3-ditert-butyl-5-[2-[3-[2-(3,5-ditert-butylphenyl)ethenyl]-5-ethynylphenyl]ethenyl]benzene (PubChem CID 86592750) has the molecular formula C40H50 and a molecular weight of 530.84 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-[2-[3-[2-(3,5-ditert-butylphenyl)ethenyl]-5-ethynylphenyl]ethenyl]benzene.
| Compound Name | 1,3-ditert-butyl-5-[2-[3-[2-(3,5-ditert-butylphenyl)ethenyl]-5-ethynylphenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 86592750 |
| Molecular Formula | C40H50 |
| Molecular Weight | 530.84 g/mol |
| Exact Mass | 530.39 |
| IUPAC Name | 1,3-ditert-butyl-5-[2-[3-[2-(3,5-ditert-butylphenyl)ethenyl]-5-ethynylphenyl]ethenyl]benzene |
| SMILES | C#Cc1cc(C=Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C=Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C40H50/c1-14-28-19-29(15-17-31-22-33(37(2,3)4)26-34(23-31)38(5,6)7)21-30(20-28)16-18-32-24-35(39(8,9)10)27-36(25-32)40(11,12)13/h1,15-27H,2-13H3 |
| InChIKey | VUIIPZMAPLLLAG-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.84 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|