C16H16F3NO3 — CID 86592988
ethyl 3-[2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]prop-2-enoate (PubChem CID 86592988) has the molecular formula C16H16F3NO3 and a molecular weight of 327.30 g/mol. Its IUPAC name is ethyl 3-[2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]prop-2-enoate.
| Compound Name | ethyl 3-[2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]prop-2-enoate |
|---|---|
| PubChem CID | 86592988 |
| Molecular Formula | C16H16F3NO3 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | ethyl 3-[2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc2c(c1)CN(C(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C16H16F3NO3/c1-2-23-14(21)6-4-11-3-5-12-7-8-20(10-13(12)9-11)15(22)16(17,18)19/h3-6,9H,2,7-8,10H2,1H3 |
| InChIKey | JQTSQIYLIAAWPG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|