C24H31NO2 — CID 86593481
4-[(3,5-ditert-butylphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-6-carbaldehyde (PubChem CID 86593481) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 4-[(3,5-ditert-butylphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-6-carbaldehyde.
| Compound Name | 4-[(3,5-ditert-butylphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-6-carbaldehyde |
|---|---|
| PubChem CID | 86593481 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 4-[(3,5-ditert-butylphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-6-carbaldehyde |
| SMILES | CC(C)(C)c1cc(CN2CCOc3ccc(C=O)cc32)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H31NO2/c1-23(2,3)19-11-18(12-20(14-19)24(4,5)6)15-25-9-10-27-22-8-7-17(16-26)13-21(22)25/h7-8,11-14,16H,9-10,15H2,1-6H3 |
| InChIKey | PRSVYZIGTDXCIY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|