C25H28N4O8S3 — CID 86593912
methanesulfonic acid;N-[2-[4-[4-(6-methoxy-3-pyridinyl)-2-(pyridin-2-ylsulfanylmethyl)-1,3-oxazol-5-yl]phenoxy]ethyl]methanesulfonamide (PubChem CID 86593912) has the molecular formula C25H28N4O8S3 and a molecular weight of 608.72 g/mol. Its IUPAC name is methanesulfonic acid;N-[2-[4-[4-(6-methoxy-3-pyridinyl)-2-(pyridin-2-ylsulfanylmethyl)-1,3-oxazol-5-yl]phenoxy]ethyl]methanesulfonamide.
| Compound Name | methanesulfonic acid;N-[2-[4-[4-(6-methoxy-3-pyridinyl)-2-(pyridin-2-ylsulfanylmethyl)-1,3-oxazol-5-yl]phenoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 86593912 |
| Molecular Formula | C25H28N4O8S3 |
| Molecular Weight | 608.72 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | methanesulfonic acid;N-[2-[4-[4-(6-methoxy-3-pyridinyl)-2-(pyridin-2-ylsulfanylmethyl)-1,3-oxazol-5-yl]phenoxy]ethyl]methanesulfonamide |
| SMILES | COc1ccc(-c2nc(CSc3ccccn3)oc2-c2ccc(OCCNS(C)(=O)=O)cc2)cn1.CS(=O)(=O)O |
| InChI | InChI=1S/C24H24N4O5S2.CH4O3S/c1-31-20-11-8-18(15-26-20)23-24(33-21(28-23)16-34-22-5-3-4-12-25-22)17-6-9-19(10-7-17)32-14-13-27-35(2,29)30;1-5(2,3)4/h3-12,15,27H,13-14,16H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | QEXYQIUDTULCPD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 170.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.72 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|