About 7-amino-4H-1,4-benzoxazine-3-thione
7-amino-4H-1,4-benzoxazine-3-thione (PubChem CID 86593929) has the molecular formula C8H8N2OS
and a molecular weight of 180.23 g/mol. Its IUPAC name is 7-amino-4H-1,4-benzoxazine-3-thione.
Molecular Properties
| Compound Name | 7-amino-4H-1,4-benzoxazine-3-thione |
| PubChem CID | 86593929 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 7-amino-4H-1,4-benzoxazine-3-thione |
| SMILES | Nc1ccc2c(c1)OCC(=S)N2 |
| InChI | InChI=1S/C8H8N2OS/c9-5-1-2-6-7(3-5)11-4-8(12)10-6/h1-3H,4,9H2,(H,10,12) |
| InChIKey | LUVOAPSJJAZMLS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-4H-1,4-benzoxazine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-4H-1,4-benzoxazine-3-thione?
The IUPAC name of 7-amino-4H-1,4-benzoxazine-3-thione (CID 86593929) is 7-amino-4H-1,4-benzoxazine-3-thione.
What is the SMILES notation for 7-amino-4H-1,4-benzoxazine-3-thione?
The canonical SMILES for 7-amino-4H-1,4-benzoxazine-3-thione is Nc1ccc2c(c1)OCC(=S)N2.
What is the InChIKey of 7-amino-4H-1,4-benzoxazine-3-thione?
The InChIKey is LUVOAPSJJAZMLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2OS/c9-5-1-2-6-7(3-5)11-4-8(12)10-6/h1-3H,4,9H2,(H,10,12).
What are the key properties of 7-amino-4H-1,4-benzoxazine-3-thione?
7-amino-4H-1,4-benzoxazine-3-thione has a molecular weight of 180.23 g/mol, XLogP of 1.40, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-4H-1,4-benzoxazine-3-thione is sourced from PubChem (CID 86593929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).