C28H24N4O4S — CID 86593969
N-[1-[2-(2-formamido-1,3-thiazol-4-yl)acetyl]-2,3-dihydroindol-5-yl]-2-(4-methoxyphenyl)benzamide (PubChem CID 86593969) has the molecular formula C28H24N4O4S and a molecular weight of 512.59 g/mol. Its IUPAC name is N-[1-[2-(2-formamido-1,3-thiazol-4-yl)acetyl]-2,3-dihydroindol-5-yl]-2-(4-methoxyphenyl)benzamide.
| Compound Name | N-[1-[2-(2-formamido-1,3-thiazol-4-yl)acetyl]-2,3-dihydroindol-5-yl]-2-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 86593969 |
| Molecular Formula | C28H24N4O4S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | N-[1-[2-(2-formamido-1,3-thiazol-4-yl)acetyl]-2,3-dihydroindol-5-yl]-2-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(-c2ccccc2C(=O)Nc2ccc3c(c2)CCN3C(=O)Cc2csc(NC=O)n2)cc1 |
| InChI | InChI=1S/C28H24N4O4S/c1-36-22-9-6-18(7-10-22)23-4-2-3-5-24(23)27(35)30-20-8-11-25-19(14-20)12-13-32(25)26(34)15-21-16-37-28(31-21)29-17-33/h2-11,14,16-17H,12-13,15H2,1H3,(H,30,35)(H,29,31,33) |
| InChIKey | ANULMVMJILMYNC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|