About 1-[(1R,2R)-2-hydroxycyclohexyl]piperidin-4-one
1-[(1R,2R)-2-hydroxycyclohexyl]piperidin-4-one (PubChem CID 86594081) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-[(1R,2R)-2-hydroxycyclohexyl]piperidin-4-one.
Molecular Properties
| Compound Name | 1-[(1R,2R)-2-hydroxycyclohexyl]piperidin-4-one |
| PubChem CID | 86594081 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 1-[(1R,2R)-2-hydroxycyclohexyl]piperidin-4-one |
| SMILES | O=C1CCN([C@@H]2CCCC[C@H]2O)CC1 |
| InChI | InChI=1S/C11H19NO2/c13-9-5-7-12(8-6-9)10-3-1-2-4-11(10)14/h10-11,14H,1-8H2/t10-,11-/m1/s1 |
| InChIKey | LBDNHRHMPHDTNU-GHMZBOCLSA-N |
| XLogP | 0.95 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1R,2R)-2-hydroxycyclohexyl]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2R)-2-hydroxycyclohexyl]piperidin-4-one?
The IUPAC name of 1-[(1R,2R)-2-hydroxycyclohexyl]piperidin-4-one (CID 86594081) is 1-[(1R,2R)-2-hydroxycyclohexyl]piperidin-4-one.
What is the SMILES notation for 1-[(1R,2R)-2-hydroxycyclohexyl]piperidin-4-one?
The canonical SMILES for 1-[(1R,2R)-2-hydroxycyclohexyl]piperidin-4-one is O=C1CCN([C@@H]2CCCC[C@H]2O)CC1.
What is the InChIKey of 1-[(1R,2R)-2-hydroxycyclohexyl]piperidin-4-one?
The InChIKey is LBDNHRHMPHDTNU-GHMZBOCLSA-N. The full InChI is InChI=1S/C11H19NO2/c13-9-5-7-12(8-6-9)10-3-1-2-4-11(10)14/h10-11,14H,1-8H2/t10-,11-/m1/s1.
What are the key properties of 1-[(1R,2R)-2-hydroxycyclohexyl]piperidin-4-one?
1-[(1R,2R)-2-hydroxycyclohexyl]piperidin-4-one has a molecular weight of 197.28 g/mol, XLogP of 0.95, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2R)-2-hydroxycyclohexyl]piperidin-4-one is sourced from PubChem (CID 86594081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).