C28H33F2NO3 — CID 86594129
3-[3-[3,5-ditert-butyl-2-(2,2-difluoroethoxy)phenyl]-1H-indol-5-yl]but-2-enoic acid (PubChem CID 86594129) has the molecular formula C28H33F2NO3 and a molecular weight of 469.57 g/mol. Its IUPAC name is 3-[3-[3,5-ditert-butyl-2-(2,2-difluoroethoxy)phenyl]-1H-indol-5-yl]but-2-enoic acid.
| Compound Name | 3-[3-[3,5-ditert-butyl-2-(2,2-difluoroethoxy)phenyl]-1H-indol-5-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 86594129 |
| Molecular Formula | C28H33F2NO3 |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 3-[3-[3,5-ditert-butyl-2-(2,2-difluoroethoxy)phenyl]-1H-indol-5-yl]but-2-enoic acid |
| SMILES | CC(=CC(=O)O)c1ccc2[nH]cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3OCC(F)F)c2c1 |
| InChI | InChI=1S/C28H33F2NO3/c1-16(10-25(32)33)17-8-9-23-19(11-17)21(14-31-23)20-12-18(27(2,3)4)13-22(28(5,6)7)26(20)34-15-24(29)30/h8-14,24,31H,15H2,1-7H3,(H,32,33) |
| InChIKey | POAAIJQVWHRDMG-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|