About 1H-indole;1,3-oxazole;1,3-thiazole
1H-indole;1,3-oxazole;1,3-thiazole (PubChem CID 86594208) has the molecular formula C14H13N3OS
and a molecular weight of 271.35 g/mol. Its IUPAC name is 1H-indole;1,3-oxazole;1,3-thiazole.
Molecular Properties
| Compound Name | 1H-indole;1,3-oxazole;1,3-thiazole |
| PubChem CID | 86594208 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 1H-indole;1,3-oxazole;1,3-thiazole |
| SMILES | c1ccc2[nH]ccc2c1.c1cocn1.c1cscn1 |
| InChI | InChI=1S/C8H7N.C3H3NO.C3H3NS/c1-2-4-8-7(3-1)5-6-9-8;2*1-2-5-3-4-1/h1-6,9H;2*1-3H |
| InChIKey | HWJCLUJSBMKREW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-indole;1,3-oxazole;1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;1,3-oxazole;1,3-thiazole?
The IUPAC name of 1H-indole;1,3-oxazole;1,3-thiazole (CID 86594208) is 1H-indole;1,3-oxazole;1,3-thiazole.
What is the SMILES notation for 1H-indole;1,3-oxazole;1,3-thiazole?
The canonical SMILES for 1H-indole;1,3-oxazole;1,3-thiazole is c1ccc2[nH]ccc2c1.c1cocn1.c1cscn1.
What is the InChIKey of 1H-indole;1,3-oxazole;1,3-thiazole?
The InChIKey is HWJCLUJSBMKREW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C3H3NO.C3H3NS/c1-2-4-8-7(3-1)5-6-9-8;2*1-2-5-3-4-1/h1-6,9H;2*1-3H.
What are the key properties of 1H-indole;1,3-oxazole;1,3-thiazole?
1H-indole;1,3-oxazole;1,3-thiazole has a molecular weight of 271.35 g/mol, XLogP of 3.99, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;1,3-oxazole;1,3-thiazole is sourced from PubChem (CID 86594208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).