About N-methylspiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]octane]-3'-amine
N-methylspiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]octane]-3'-amine (PubChem CID 86594335) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is N-methylspiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]octane]-3'-amine.
Molecular Properties
| Compound Name | N-methylspiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]octane]-3'-amine |
| PubChem CID | 86594335 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | N-methylspiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]octane]-3'-amine |
| SMILES | CNC1CC2CCC(C1)C21OCCO1 |
| InChI | InChI=1S/C11H19NO2/c1-12-10-6-8-2-3-9(7-10)11(8)13-4-5-14-11/h8-10,12H,2-7H2,1H3 |
| InChIKey | ANKQJQZNZKHECC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methylspiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]octane]-3'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylspiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]octane]-3'-amine?
The IUPAC name of N-methylspiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]octane]-3'-amine (CID 86594335) is N-methylspiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]octane]-3'-amine.
What is the SMILES notation for N-methylspiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]octane]-3'-amine?
The canonical SMILES for N-methylspiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]octane]-3'-amine is CNC1CC2CCC(C1)C21OCCO1.
What is the InChIKey of N-methylspiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]octane]-3'-amine?
The InChIKey is ANKQJQZNZKHECC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-12-10-6-8-2-3-9(7-10)11(8)13-4-5-14-11/h8-10,12H,2-7H2,1H3.
What are the key properties of N-methylspiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]octane]-3'-amine?
N-methylspiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]octane]-3'-amine has a molecular weight of 197.28 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylspiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]octane]-3'-amine is sourced from PubChem (CID 86594335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).