About N-carbamothioyl-5,7-dimethyl-1H-indole-2-carboxamide
N-carbamothioyl-5,7-dimethyl-1H-indole-2-carboxamide (PubChem CID 86594514) has the molecular formula C12H13N3OS
and a molecular weight of 247.32 g/mol. Its IUPAC name is N-carbamothioyl-5,7-dimethyl-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | N-carbamothioyl-5,7-dimethyl-1H-indole-2-carboxamide |
| PubChem CID | 86594514 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | N-carbamothioyl-5,7-dimethyl-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)c2[nH]c(C(=O)NC(N)=S)cc2c1 |
| InChI | InChI=1S/C12H13N3OS/c1-6-3-7(2)10-8(4-6)5-9(14-10)11(16)15-12(13)17/h3-5,14H,1-2H3,(H3,13,15,16,17) |
| InChIKey | ZZDJSNOKTMBOFO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-carbamothioyl-5,7-dimethyl-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamothioyl-5,7-dimethyl-1H-indole-2-carboxamide?
The IUPAC name of N-carbamothioyl-5,7-dimethyl-1H-indole-2-carboxamide (CID 86594514) is N-carbamothioyl-5,7-dimethyl-1H-indole-2-carboxamide.
What is the SMILES notation for N-carbamothioyl-5,7-dimethyl-1H-indole-2-carboxamide?
The canonical SMILES for N-carbamothioyl-5,7-dimethyl-1H-indole-2-carboxamide is Cc1cc(C)c2[nH]c(C(=O)NC(N)=S)cc2c1.
What is the InChIKey of N-carbamothioyl-5,7-dimethyl-1H-indole-2-carboxamide?
The InChIKey is ZZDJSNOKTMBOFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3OS/c1-6-3-7(2)10-8(4-6)5-9(14-10)11(16)15-12(13)17/h3-5,14H,1-2H3,(H3,13,15,16,17).
What are the key properties of N-carbamothioyl-5,7-dimethyl-1H-indole-2-carboxamide?
N-carbamothioyl-5,7-dimethyl-1H-indole-2-carboxamide has a molecular weight of 247.32 g/mol, XLogP of 1.76, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamothioyl-5,7-dimethyl-1H-indole-2-carboxamide is sourced from PubChem (CID 86594514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).