C23H27F3O3 — CID 86594542
(2E,4E,6Z)-8,8,8-trifluoro-7-(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-3-methylocta-2,4,6-trienoic acid (PubChem CID 86594542) has the molecular formula C23H27F3O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is (2E,4E,6Z)-8,8,8-trifluoro-7-(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-3-methylocta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6Z)-8,8,8-trifluoro-7-(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 86594542 |
| Molecular Formula | C23H27F3O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | (2E,4E,6Z)-8,8,8-trifluoro-7-(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-3-methylocta-2,4,6-trienoic acid |
| SMILES | CC(/C=C/C=C(/c1cc2c(cc1O)C(C)(C)CCC2(C)C)C(F)(F)F)=C\C(=O)O |
| InChI | InChI=1S/C23H27F3O3/c1-14(11-20(28)29)7-6-8-16(23(24,25)26)15-12-17-18(13-19(15)27)22(4,5)10-9-21(17,2)3/h6-8,11-13,27H,9-10H2,1-5H3,(H,28,29)/b7-6+,14-11+,16-8- |
| InChIKey | GYZDXOMXZWACNG-FSDQSWQWSA-N |
| XLogP | 6.27 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|