C24H27N5O4S — CID 86594976
(2S)-2-(1,3-benzothiazol-2-ylamino)-3-[4-[4-oxo-4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)butoxy]phenyl]propanoic acid (PubChem CID 86594976) has the molecular formula C24H27N5O4S and a molecular weight of 481.58 g/mol. Its IUPAC name is (2S)-2-(1,3-benzothiazol-2-ylamino)-3-[4-[4-oxo-4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)butoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(1,3-benzothiazol-2-ylamino)-3-[4-[4-oxo-4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)butoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 86594976 |
| Molecular Formula | C24H27N5O4S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (2S)-2-(1,3-benzothiazol-2-ylamino)-3-[4-[4-oxo-4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)butoxy]phenyl]propanoic acid |
| SMILES | O=C(CCCOc1ccc(C[C@H](Nc2nc3ccccc3s2)C(=O)O)cc1)NC1=NCCCN1 |
| InChI | InChI=1S/C24H27N5O4S/c30-21(29-23-25-12-4-13-26-23)7-3-14-33-17-10-8-16(9-11-17)15-19(22(31)32)28-24-27-18-5-1-2-6-20(18)34-24/h1-2,5-6,8-11,19H,3-4,7,12-15H2,(H,27,28)(H,31,32)(H2,25,26,29,30)/t19-/m0/s1 |
| InChIKey | SZLSQAZJDAEMBM-IBGZPJMESA-N |
| XLogP | 3.03 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|