About 4-fluoro-1-piperidin-4-yl-3,3a-dihydroimidazo[4,5-b]pyridin-2-one
4-fluoro-1-piperidin-4-yl-3,3a-dihydroimidazo[4,5-b]pyridin-2-one (PubChem CID 86595029) has the molecular formula C11H15FN4O
and a molecular weight of 238.27 g/mol. Its IUPAC name is 4-fluoro-1-piperidin-4-yl-3,3a-dihydroimidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 4-fluoro-1-piperidin-4-yl-3,3a-dihydroimidazo[4,5-b]pyridin-2-one |
| PubChem CID | 86595029 |
| Molecular Formula | C11H15FN4O |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-fluoro-1-piperidin-4-yl-3,3a-dihydroimidazo[4,5-b]pyridin-2-one |
| SMILES | O=C1NC2C(=CC=CN2F)N1C1CCNCC1 |
| InChI | InChI=1S/C11H15FN4O/c12-15-7-1-2-9-10(15)14-11(17)16(9)8-3-5-13-6-4-8/h1-2,7-8,10,13H,3-6H2,(H,14,17) |
| InChIKey | XIYNBODCZBHHAS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-1-piperidin-4-yl-3,3a-dihydroimidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-piperidin-4-yl-3,3a-dihydroimidazo[4,5-b]pyridin-2-one?
The IUPAC name of 4-fluoro-1-piperidin-4-yl-3,3a-dihydroimidazo[4,5-b]pyridin-2-one (CID 86595029) is 4-fluoro-1-piperidin-4-yl-3,3a-dihydroimidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 4-fluoro-1-piperidin-4-yl-3,3a-dihydroimidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 4-fluoro-1-piperidin-4-yl-3,3a-dihydroimidazo[4,5-b]pyridin-2-one is O=C1NC2C(=CC=CN2F)N1C1CCNCC1.
What is the InChIKey of 4-fluoro-1-piperidin-4-yl-3,3a-dihydroimidazo[4,5-b]pyridin-2-one?
The InChIKey is XIYNBODCZBHHAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FN4O/c12-15-7-1-2-9-10(15)14-11(17)16(9)8-3-5-13-6-4-8/h1-2,7-8,10,13H,3-6H2,(H,14,17).
What are the key properties of 4-fluoro-1-piperidin-4-yl-3,3a-dihydroimidazo[4,5-b]pyridin-2-one?
4-fluoro-1-piperidin-4-yl-3,3a-dihydroimidazo[4,5-b]pyridin-2-one has a molecular weight of 238.27 g/mol, XLogP of 0.69, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-piperidin-4-yl-3,3a-dihydroimidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 86595029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).