About ethyl 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxopentan-3-yl]imidazole-4-carboxylate
ethyl 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxopentan-3-yl]imidazole-4-carboxylate (PubChem CID 86595162) has the molecular formula C17H30N2O4Si
and a molecular weight of 354.52 g/mol. Its IUPAC name is ethyl 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxopentan-3-yl]imidazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxopentan-3-yl]imidazole-4-carboxylate |
| PubChem CID | 86595162 |
| Molecular Formula | C17H30N2O4Si |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | ethyl 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxopentan-3-yl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn([C@H](CC=O)[C@H](C)O[Si](C)(C)C(C)(C)C)cn1 |
| InChI | InChI=1S/C17H30N2O4Si/c1-8-22-16(21)14-11-19(12-18-14)15(9-10-20)13(2)23-24(6,7)17(3,4)5/h10-13,15H,8-9H2,1-7H3/t13-,15+/m0/s1 |
| InChIKey | CVWKYHVTQXPAQV-DZGCQCFKSA-N |
| XLogP | 3.60 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxopentan-3-yl]imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxopentan-3-yl]imidazole-4-carboxylate?
The IUPAC name of ethyl 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxopentan-3-yl]imidazole-4-carboxylate (CID 86595162) is ethyl 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxopentan-3-yl]imidazole-4-carboxylate.
What is the SMILES notation for ethyl 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxopentan-3-yl]imidazole-4-carboxylate?
The canonical SMILES for ethyl 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxopentan-3-yl]imidazole-4-carboxylate is CCOC(=O)c1cn([C@H](CC=O)[C@H](C)O[Si](C)(C)C(C)(C)C)cn1.
What is the InChIKey of ethyl 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxopentan-3-yl]imidazole-4-carboxylate?
The InChIKey is CVWKYHVTQXPAQV-DZGCQCFKSA-N. The full InChI is InChI=1S/C17H30N2O4Si/c1-8-22-16(21)14-11-19(12-18-14)15(9-10-20)13(2)23-24(6,7)17(3,4)5/h10-13,15H,8-9H2,1-7H3/t13-,15+/m0/s1.
What are the key properties of ethyl 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxopentan-3-yl]imidazole-4-carboxylate?
ethyl 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxopentan-3-yl]imidazole-4-carboxylate has a molecular weight of 354.52 g/mol, XLogP of 3.60, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxopentan-3-yl]imidazole-4-carboxylate is sourced from PubChem (CID 86595162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).