C21H24ClF3N6O4S — CID 86595390
2-[6-cyano-3-[[2,2-difluoro-2-(2-methylsulfonylphenyl)ethyl]amino]-2-fluorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;hydrochloride (PubChem CID 86595390) has the molecular formula C21H24ClF3N6O4S and a molecular weight of 548.98 g/mol. Its IUPAC name is 2-[6-cyano-3-[[2,2-difluoro-2-(2-methylsulfonylphenyl)ethyl]amino]-2-fluorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;hydrochloride.
| Compound Name | 2-[6-cyano-3-[[2,2-difluoro-2-(2-methylsulfonylphenyl)ethyl]amino]-2-fluorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 86595390 |
| Molecular Formula | C21H24ClF3N6O4S |
| Molecular Weight | 548.98 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | 2-[6-cyano-3-[[2,2-difluoro-2-(2-methylsulfonylphenyl)ethyl]amino]-2-fluorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;hydrochloride |
| SMILES | CS(=O)(=O)c1ccccc1C(F)(F)CNc1ccc(C#N)c(CC(=O)NCCON=C(N)N)c1F.Cl |
| InChI | InChI=1S/C21H23F3N6O4S.ClH/c1-35(32,33)17-5-3-2-4-15(17)21(23,24)12-29-16-7-6-13(11-25)14(19(16)22)10-18(31)28-8-9-34-30-20(26)27;/h2-7,29H,8-10,12H2,1H3,(H,28,31)(H4,26,27,30);1H |
| InChIKey | PYDAEBFKTPASAY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 172.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.98 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|