C11H16ClNO5S — CID 86595502
(2S)-1-[(2S)-3-(chloromethoxycarbonylsulfanyl)-2-methylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 86595502) has the molecular formula C11H16ClNO5S and a molecular weight of 309.77 g/mol. Its IUPAC name is (2S)-1-[(2S)-3-(chloromethoxycarbonylsulfanyl)-2-methylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-3-(chloromethoxycarbonylsulfanyl)-2-methylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 86595502 |
| Molecular Formula | C11H16ClNO5S |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | (2S)-1-[(2S)-3-(chloromethoxycarbonylsulfanyl)-2-methylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | C[C@H](CSC(=O)OCCl)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C11H16ClNO5S/c1-7(5-19-11(17)18-6-12)9(14)13-4-2-3-8(13)10(15)16/h7-8H,2-6H2,1H3,(H,15,16)/t7-,8+/m1/s1 |
| InChIKey | ZVEIHRBPYPASDD-SFYZADRCSA-N |
| XLogP | 1.76 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|