C23H23FN2O7-2 — CID 86595686
(2R,3R)-2,3-dihydroxybutanedioate;(1R)-1-(4-fluorophenyl)-1-[3-(methylamino)propyl]-3H-2-benzofuran-5-carbonitrile (PubChem CID 86595686) has the molecular formula C23H23FN2O7-2 and a molecular weight of 458.44 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioate;(1R)-1-(4-fluorophenyl)-1-[3-(methylamino)propyl]-3H-2-benzofuran-5-carbonitrile.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioate;(1R)-1-(4-fluorophenyl)-1-[3-(methylamino)propyl]-3H-2-benzofuran-5-carbonitrile |
|---|---|
| PubChem CID | 86595686 |
| Molecular Formula | C23H23FN2O7-2 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioate;(1R)-1-(4-fluorophenyl)-1-[3-(methylamino)propyl]-3H-2-benzofuran-5-carbonitrile |
| SMILES | CNCCC[C@]1(c2ccc(F)cc2)OCc2cc(C#N)ccc21.O=C([O-])[C@H](O)[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C19H19FN2O.C4H6O6/c1-22-10-2-9-19(16-4-6-17(20)7-5-16)18-8-3-14(12-21)11-15(18)13-23-19;5-1(3(7)8)2(6)4(9)10/h3-8,11,22H,2,9-10,13H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/p-2/t19-;1-,2-/m11/s1 |
| InChIKey | SUJMSAUIOJVXRG-AOSJBURYSA-L |
| XLogP | -1.32 |
| TPSA | 165.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|