C38H38O11 — CID 86595691
bis[6-(2-oxochromen-7-yl)oxyhexyl] 5-hydroxybenzene-1,3-dicarboxylate (PubChem CID 86595691) has the molecular formula C38H38O11 and a molecular weight of 670.71 g/mol. Its IUPAC name is bis[6-(2-oxochromen-7-yl)oxyhexyl] 5-hydroxybenzene-1,3-dicarboxylate.
| Compound Name | bis[6-(2-oxochromen-7-yl)oxyhexyl] 5-hydroxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 86595691 |
| Molecular Formula | C38H38O11 |
| Molecular Weight | 670.71 g/mol |
| Exact Mass | 670.24 |
| IUPAC Name | bis[6-(2-oxochromen-7-yl)oxyhexyl] 5-hydroxybenzene-1,3-dicarboxylate |
| SMILES | O=C(OCCCCCCOc1ccc2ccc(=O)oc2c1)c1cc(O)cc(C(=O)OCCCCCCOc2ccc3ccc(=O)oc3c2)c1 |
| InChI | InChI=1S/C38H38O11/c39-30-22-28(37(42)46-19-7-3-1-5-17-44-31-13-9-26-11-15-35(40)48-33(26)24-31)21-29(23-30)38(43)47-20-8-4-2-6-18-45-32-14-10-27-12-16-36(41)49-34(27)25-32/h9-16,21-25,39H,1-8,17-20H2 |
| InChIKey | UTLIKPSDTQYTHB-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 151.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.71 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|