C30H25ClN2S — CID 86596331
(4S,5R)-2-(anthracen-9-ylmethylsulfanyl)-4,5-diphenyl-4,5-dihydro-1H-imidazole;hydrochloride (PubChem CID 86596331) has the molecular formula C30H25ClN2S and a molecular weight of 481.06 g/mol. Its IUPAC name is (4S,5R)-2-(anthracen-9-ylmethylsulfanyl)-4,5-diphenyl-4,5-dihydro-1H-imidazole;hydrochloride.
| Compound Name | (4S,5R)-2-(anthracen-9-ylmethylsulfanyl)-4,5-diphenyl-4,5-dihydro-1H-imidazole;hydrochloride |
|---|---|
| PubChem CID | 86596331 |
| Molecular Formula | C30H25ClN2S |
| Molecular Weight | 481.06 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | (4S,5R)-2-(anthracen-9-ylmethylsulfanyl)-4,5-diphenyl-4,5-dihydro-1H-imidazole;hydrochloride |
| SMILES | Cl.c1ccc([C@H]2NC(SCc3c4ccccc4cc4ccccc34)=N[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24N2S.ClH/c1-3-11-21(12-4-1)28-29(22-13-5-2-6-14-22)32-30(31-28)33-20-27-25-17-9-7-15-23(25)19-24-16-8-10-18-26(24)27;/h1-19,28-29H,20H2,(H,31,32);1H/t28-,29+; |
| InChIKey | GXJJFRGVPDUDQS-UQJAOHHKSA-N |
| XLogP | 8.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.06 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|