C30H30F3N5O3S — CID 86596578
N-[4-[4-[2-(2-formamido-1,3-thiazol-4-yl)acetyl]piperazin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]cyclohexene-1-carboxamide (PubChem CID 86596578) has the molecular formula C30H30F3N5O3S and a molecular weight of 597.66 g/mol. Its IUPAC name is N-[4-[4-[2-(2-formamido-1,3-thiazol-4-yl)acetyl]piperazin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]cyclohexene-1-carboxamide.
| Compound Name | N-[4-[4-[2-(2-formamido-1,3-thiazol-4-yl)acetyl]piperazin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 86596578 |
| Molecular Formula | C30H30F3N5O3S |
| Molecular Weight | 597.66 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | N-[4-[4-[2-(2-formamido-1,3-thiazol-4-yl)acetyl]piperazin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]cyclohexene-1-carboxamide |
| SMILES | O=CNc1nc(CC(=O)N2CCN(c3ccc(NC(=O)C4=C(c5ccc(C(F)(F)F)cc5)CCCC4)cc3)CC2)cs1 |
| InChI | InChI=1S/C30H30F3N5O3S/c31-30(32,33)21-7-5-20(6-8-21)25-3-1-2-4-26(25)28(41)35-22-9-11-24(12-10-22)37-13-15-38(16-14-37)27(40)17-23-18-42-29(36-23)34-19-39/h5-12,18-19H,1-4,13-17H2,(H,35,41)(H,34,36,39) |
| InChIKey | NKJOUQPTENKJOW-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|