C26H33N3O3S — CID 86596987
N-[[4-[[[(3aS,9bR)-7-hydroxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]benzenesulfonamide (PubChem CID 86596987) has the molecular formula C26H33N3O3S and a molecular weight of 467.64 g/mol. Its IUPAC name is N-[[4-[[[(3aS,9bR)-7-hydroxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]benzenesulfonamide.
| Compound Name | N-[[4-[[[(3aS,9bR)-7-hydroxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 86596987 |
| Molecular Formula | C26H33N3O3S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-[[4-[[[(3aS,9bR)-7-hydroxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCC(CNC2=N[C@H]3CCc4cc(O)ccc4[C@H]3C2)CC1)c1ccccc1 |
| InChI | InChI=1S/C26H33N3O3S/c30-21-11-12-23-20(14-21)10-13-25-24(23)15-26(29-25)27-16-18-6-8-19(9-7-18)17-28-33(31,32)22-4-2-1-3-5-22/h1-5,11-12,14,18-19,24-25,28,30H,6-10,13,15-17H2,(H,27,29)/t18?,19?,24-,25+/m1/s1 |
| InChIKey | WVLBEZFZHMDGBG-ZTHRNYAASA-N |
| XLogP | 3.97 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |