C17H21NO — CID 86597286
4-[2-(3-methylphenyl)ethynyl]-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol (PubChem CID 86597286) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 4-[2-(3-methylphenyl)ethynyl]-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol.
| Compound Name | 4-[2-(3-methylphenyl)ethynyl]-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol |
|---|---|
| PubChem CID | 86597286 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 4-[2-(3-methylphenyl)ethynyl]-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol |
| SMILES | Cc1cccc(C#CC2(O)CCCC3CNCC32)c1 |
| InChI | InChI=1S/C17H21NO/c1-13-4-2-5-14(10-13)7-9-17(19)8-3-6-15-11-18-12-16(15)17/h2,4-5,10,15-16,18-19H,3,6,8,11-12H2,1H3 |
| InChIKey | KALJRNNEKZDUEQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|