C14H20O10 — CID 86597508
(4R,5R,6R,7R)-5,6-diacetyl-4,5,6,7,8-pentahydroxydecane-2,3,9-trione (PubChem CID 86597508) has the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. Its IUPAC name is (4R,5R,6R,7R)-5,6-diacetyl-4,5,6,7,8-pentahydroxydecane-2,3,9-trione.
| Compound Name | (4R,5R,6R,7R)-5,6-diacetyl-4,5,6,7,8-pentahydroxydecane-2,3,9-trione |
|---|---|
| PubChem CID | 86597508 |
| Molecular Formula | C14H20O10 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (4R,5R,6R,7R)-5,6-diacetyl-4,5,6,7,8-pentahydroxydecane-2,3,9-trione |
| SMILES | CC(=O)C(=O)[C@H](O)[C@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@H](O)C(O)C(C)=O |
| InChI | InChI=1S/C14H20O10/c1-5(15)9(19)11(21)13(23,7(3)17)14(24,8(4)18)12(22)10(20)6(2)16/h9,11-12,19,21-24H,1-4H3/t9?,11-,12+,13-,14-/m1/s1 |
| InChIKey | AHUYXDMVHMWLOX-IBYNPJLGSA-N |
| XLogP | -3.54 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|