About tetrabutylazanium;hydroxide;hydrate
tetrabutylazanium;hydroxide;hydrate (PubChem CID 86597561) has the molecular formula C16H39NO2
and a molecular weight of 277.49 g/mol. Its IUPAC name is tetrabutylazanium;hydroxide;hydrate.
Molecular Properties
| Compound Name | tetrabutylazanium;hydroxide;hydrate |
| PubChem CID | 86597561 |
| Molecular Formula | C16H39NO2 |
| Molecular Weight | 277.49 g/mol |
| Exact Mass | 277.30 |
| IUPAC Name | tetrabutylazanium;hydroxide;hydrate |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O.[OH-] |
| InChI | InChI=1S/C16H36N.2H2O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;/h5-16H2,1-4H3;2*1H2/q+1;;/p-1 |
| InChIKey | CWQQNNGLDZEOBJ-UHFFFAOYSA-M |
| XLogP | 4.00 |
| TPSA | 61.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium;hydroxide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium;hydroxide;hydrate?
The IUPAC name of tetrabutylazanium;hydroxide;hydrate (CID 86597561) is tetrabutylazanium;hydroxide;hydrate.
What is the SMILES notation for tetrabutylazanium;hydroxide;hydrate?
The canonical SMILES for tetrabutylazanium;hydroxide;hydrate is CCCC[N+](CCCC)(CCCC)CCCC.O.[OH-].
What is the InChIKey of tetrabutylazanium;hydroxide;hydrate?
The InChIKey is CWQQNNGLDZEOBJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.2H2O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;/h5-16H2,1-4H3;2*1H2/q+1;;/p-1.
What are the key properties of tetrabutylazanium;hydroxide;hydrate?
tetrabutylazanium;hydroxide;hydrate has a molecular weight of 277.49 g/mol, XLogP of 4.00, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium;hydroxide;hydrate is sourced from PubChem (CID 86597561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).