C17H23F9N4O5 — CID 86597570
2-[3-[bis[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]propyl-(2,2,2-trifluoroacetyl)amino]acetic acid (PubChem CID 86597570) has the molecular formula C17H23F9N4O5 and a molecular weight of 534.38 g/mol. Its IUPAC name is 2-[3-[bis[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]propyl-(2,2,2-trifluoroacetyl)amino]acetic acid.
| Compound Name | 2-[3-[bis[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]propyl-(2,2,2-trifluoroacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 86597570 |
| Molecular Formula | C17H23F9N4O5 |
| Molecular Weight | 534.38 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 2-[3-[bis[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]propyl-(2,2,2-trifluoroacetyl)amino]acetic acid |
| SMILES | O=C(O)CN(CCCN(CCCNC(=O)C(F)(F)F)CCCNC(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C17H23F9N4O5/c18-15(19,20)12(33)27-4-1-6-29(7-2-5-28-13(34)16(21,22)23)8-3-9-30(10-11(31)32)14(35)17(24,25)26/h1-10H2,(H,27,33)(H,28,34)(H,31,32) |
| InChIKey | FNERIQARDQQCJF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|