About bicyclo[2.2.1]hept-2-ene;pent-4-enoate
bicyclo[2.2.1]hept-2-ene;pent-4-enoate (PubChem CID 86597587) has the molecular formula C12H17O2-
and a molecular weight of 193.27 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;pent-4-enoate.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-2-ene;pent-4-enoate |
| PubChem CID | 86597587 |
| Molecular Formula | C12H17O2- |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;pent-4-enoate |
| SMILES | C1=CC2CCC1C2.C=CCCC(=O)[O-] |
| InChI | InChI=1S/C7H10.C5H8O2/c1-2-7-4-3-6(1)5-7;1-2-3-4-5(6)7/h1-2,6-7H,3-5H2;2H,1,3-4H2,(H,6,7)/p-1 |
| InChIKey | XKGYUCKPOGDEDB-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-2-ene;pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-2-ene;pent-4-enoate?
The IUPAC name of bicyclo[2.2.1]hept-2-ene;pent-4-enoate (CID 86597587) is bicyclo[2.2.1]hept-2-ene;pent-4-enoate.
What is the SMILES notation for bicyclo[2.2.1]hept-2-ene;pent-4-enoate?
The canonical SMILES for bicyclo[2.2.1]hept-2-ene;pent-4-enoate is C1=CC2CCC1C2.C=CCCC(=O)[O-].
What is the InChIKey of bicyclo[2.2.1]hept-2-ene;pent-4-enoate?
The InChIKey is XKGYUCKPOGDEDB-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H10.C5H8O2/c1-2-7-4-3-6(1)5-7;1-2-3-4-5(6)7/h1-2,6-7H,3-5H2;2H,1,3-4H2,(H,6,7)/p-1.
What are the key properties of bicyclo[2.2.1]hept-2-ene;pent-4-enoate?
bicyclo[2.2.1]hept-2-ene;pent-4-enoate has a molecular weight of 193.27 g/mol, XLogP of 1.67, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-2-ene;pent-4-enoate is sourced from PubChem (CID 86597587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).