C22H29F2N5O2 — CID 86598101
N-[5-(butylaminomethyl)pyrazin-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide (PubChem CID 86598101) has the molecular formula C22H29F2N5O2 and a molecular weight of 433.50 g/mol. Its IUPAC name is N-[5-(butylaminomethyl)pyrazin-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide.
| Compound Name | N-[5-(butylaminomethyl)pyrazin-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 86598101 |
| Molecular Formula | C22H29F2N5O2 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | N-[5-(butylaminomethyl)pyrazin-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide |
| SMILES | CCCCNCc1cnc(NC(=O)C(CCC)NC(=O)Cc2cc(F)cc(F)c2)cn1 |
| InChI | InChI=1S/C22H29F2N5O2/c1-3-5-7-25-12-18-13-27-20(14-26-18)29-22(31)19(6-4-2)28-21(30)10-15-8-16(23)11-17(24)9-15/h8-9,11,13-14,19,25H,3-7,10,12H2,1-2H3,(H,28,30)(H,27,29,31) |
| InChIKey | KNZUCSAQAUSDBZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|