C37H46ClF3N4O7S2 — CID 86598286
N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-[[6-(4-methylpiperazin-1-yl)-2-pyridinyl]oxy]propan-1-amine;methanesulfonic acid (PubChem CID 86598286) has the molecular formula C37H46ClF3N4O7S2 and a molecular weight of 815.38 g/mol. Its IUPAC name is N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-[[6-(4-methylpiperazin-1-yl)-2-pyridinyl]oxy]propan-1-amine;methanesulfonic acid.
| Compound Name | N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-[[6-(4-methylpiperazin-1-yl)-2-pyridinyl]oxy]propan-1-amine;methanesulfonic acid |
|---|---|
| PubChem CID | 86598286 |
| Molecular Formula | C37H46ClF3N4O7S2 |
| Molecular Weight | 815.38 g/mol |
| Exact Mass | 814.24 |
| IUPAC Name | N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-[[6-(4-methylpiperazin-1-yl)-2-pyridinyl]oxy]propan-1-amine;methanesulfonic acid |
| SMILES | CN1CCN(c2cccc(OCCCN(Cc3cccc(C(F)(F)F)c3Cl)CC(c3ccccc3)c3ccccc3)n2)CC1.CS(=O)(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C35H38ClF3N4O.2CH4O3S/c1-41-20-22-43(23-21-41)32-17-9-18-33(40-32)44-24-10-19-42(25-29-15-8-16-31(34(29)36)35(37,38)39)26-30(27-11-4-2-5-12-27)28-13-6-3-7-14-28;2*1-5(2,3)4/h2-9,11-18,30H,10,19-26H2,1H3;2*1H3,(H,2,3,4) |
| InChIKey | QUYZERLBCHVEES-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 140.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.38 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|