C19H21ClF3N3O5S — CID 86598382
tert-butyl 2-(3-chlorophenyl)-3-(trifluoromethylsulfonyloxy)-4,5,7,8-tetrahydropyrazolo[3,4-d]azepine-6-carboxylate (PubChem CID 86598382) has the molecular formula C19H21ClF3N3O5S and a molecular weight of 495.91 g/mol. Its IUPAC name is tert-butyl 2-(3-chlorophenyl)-3-(trifluoromethylsulfonyloxy)-4,5,7,8-tetrahydropyrazolo[3,4-d]azepine-6-carboxylate.
| Compound Name | tert-butyl 2-(3-chlorophenyl)-3-(trifluoromethylsulfonyloxy)-4,5,7,8-tetrahydropyrazolo[3,4-d]azepine-6-carboxylate |
|---|---|
| PubChem CID | 86598382 |
| Molecular Formula | C19H21ClF3N3O5S |
| Molecular Weight | 495.91 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | tert-butyl 2-(3-chlorophenyl)-3-(trifluoromethylsulfonyloxy)-4,5,7,8-tetrahydropyrazolo[3,4-d]azepine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2nn(-c3cccc(Cl)c3)c(OS(=O)(=O)C(F)(F)F)c2CC1 |
| InChI | InChI=1S/C19H21ClF3N3O5S/c1-18(2,3)30-17(27)25-9-7-14-15(8-10-25)24-26(13-6-4-5-12(20)11-13)16(14)31-32(28,29)19(21,22)23/h4-6,11H,7-10H2,1-3H3 |
| InChIKey | KAUSTIAXLMNBNB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.91 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|